| As a kind of lewis acid catalyst, organotin compounds has obtained people's widespread attention and got more and more aforwd from chemist. This pape synthesized series of dialkyltin compounds containing silicon catalyst, using chlorotrimethylsilane, SLHX, chlorotriphenylstannane et.al., through the foregone synthetic route:(Me3SiCH2)2SnCl2,(Me3SiCH2)2SnO,(Me3SiCH2)2Sn(OOCC6H5)2,(Me3SiCH2)2Sn(OOCC6H4-NO2-p),(Me3SiCH2)2Sn(OOCC6H4-OCH3-p)2,Ph(Me3SiCH2)SnCl2,Ph(Me3SiCH2)SnO,Ph(Me3SiCH2)Sn(OOCC6H5)2,Ph(Me3SiCH2)Sn(OOCC6H4-NO2-p)2. Ph (Me3SiCH2)Sn(OOCC6H4-OCH3-p)2。Take synthesis citral glycol acetal, cyclohexanone ethylene ketal, isoamyl benzoate for example, in the presence of catalyst above10compounds, with continuously being investigated the catalytic capability of dialkyltin compounds containing silicon in the reaction of aldolization, ketalization and transesterification.The paper discussed some factors which affect the reaction such as different water carries, amount of catalyst, reaction time, raw materials molar ratio and research the catalytic mechanism according the experimental data. In the10compounds, the catalytic activity of Ph(Me3SiCH2)Sn(OOCC6H4-NO2-p)2is the best, under the function of this catalyst, with the catalysis of citral glycol acetal, cyclohexanone ethylene ketal, isoamyl benzoate and the condition reaching to the best referring to this thesis declare, the reaction rate of acetals can reach92.1%, the reaction rate of ketals can reach86.3%and the reaction rate of transesterification can reach87.6%.The results show that dialkyltin compounds containing silicon have good catalytic activity in the reaction of aldolization, ketalization and transesterification, mild reaction condition, the dosage of catalyst is less, less reaction by-product, easier to separate, non-corrosive reactor and so on. Therefore, the organotin compounds containing silicon should have good prospects in the fine chemical industry. |